Approval: | ISO |
---|---|
IUPAC PIN: | propan-2-yl phenylcarbamate |
IUPAC name: | isopropyl phenylcarbamate 1979 Rules: isopropyl carbanilate |
CAS name: | 1-methylethyl N-phenylcarbamate |
CAS Reg. No.: | 122-42-9 |
Formula: | C10H13NO2 |
Activity: | herbicides (carbamate) plant growth regulators (growth inhibitor) |
Notes: | The name “IPC” (ИФК) was used in the former USSR. |
Structure: | |
Pronunciation: | prō-fǎm Guide to British pronunciation |
InChIKey: | VXPLXMJHHKHSOA-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names