| Approval: | ISO |
|---|---|
| IUPAC PIN: | O-propan-2-yl hydrogen carbonodithioate |
| IUPAC name: | O-isopropyl hydrogen dithiocarbonate |
| CAS name: | O-(1-methylethyl) hydrogen carbonodithioate |
| CAS Reg. No.: | 108-25-8 |
| Formula: | C4H8OS2 |
| Activity: | herbicides (thiocarbonate) |
| Notes: | Derivatives include proxan-sodium [140-93-2]. The name “IPX” is approved by the Weed Science Society of America. The name “proxan-sodium” was formerly approved by ISO for the sodium salt. |
| Structure: |  |
| Pronunciation: | prǒks-ǎn Guide to British pronunciation |
| InChIKey: | UOJYYXATTMQQNA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C4H8OS2/c1-3(2)5-4(6)7/h3H,1-2H3,(H,6,7) |