| Approval: |
China |
| IUPAC PIN: |
6-methyl-2-propylpyrimidin-4-yl dimethylcarbamate |
| IUPAC name: |
6-methyl-2-propylpyrimidin-4-yl dimethylcarbamate |
| CAS name: |
6-methyl-2-propyl-4-pyrimidinyl N,N-dimethylcarbamate |
| CAS Reg. No.: |
2532-49-2 |
| Formula: |
C11H17N3O2 |
| Activity: |
insecticides (dimethylcarbamate) |
| Notes: |
There is no ISO common name for this substance; the name “pyramat” (嘧啶威) is approved in China, even though Pyramat is (or was) a registered trade mark in many countries. |
| Structure: |
 |
| Pronunciation: |
pīr-a-mǎt Guide to British pronunciation |
| InChIKey: |
HRLNKILMCKNVPD-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C11H17N3O2/c1-5-6-9-7-10(13-8(2)12-9)16-11(15)14(3)4/h7H,5-6H2,1-4H3 |