| Approval: | WSSA |
|---|---|
| IUPAC PIN: | 2,3,5-trichloropyridin-4-ol |
| IUPAC name: | 2,3,5-trichloropyridin-4-ol |
| CAS name: | 2,3,5-trichloro-4-pyridinol |
| CAS Reg. No.: | 1970-40-7 |
| Formula: | C5H2Cl3NO |
| Activity: | herbicides (pyridinol) |
| Notes: | There is no ISO common name for this substance; the name “pyriclor” is approved by the Weed Science Society of America. |
| Structure: | |
| Pronunciation: | pǐr-ǐ-klor Guide to British pronunciation |
| InChIKey: | XTVIFVALDYTCLL-UHFFFAOYSA-N |
| InChI: | InChI=1S/C5H2Cl3NO/c6-2-1-9-5(8)3(7)4(2)10/h1H,(H,9,10) |
A data sheet from the Compendium of Pesticide Common Names