| Approval: | ISO | 
|---|---|
| IUPAC PIN: | 2,6-dichloro-4-phenylpyridine-3,5-dicarbonitrile | 
| IUPAC name: | 2,6-dichloro-4-phenylpyridine-3,5-dicarbonitrile | 
| CAS name: | 2,6-dichloro-4-phenyl-3,5-pyridinedicarbonitrile | 
| CAS Reg. No.: | 1086-02-8 | 
| Formula: | C13H5Cl2N3 | 
| Activity: | fungicides (pyridine) | 
| Notes: | The name “DDPP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. | 
| Structure: | |
| Pronunciation: | pǐr-ǐ-dǐ-nī-trǐl Guide to British pronunciation | 
| InChIKey: | OVZITGHGWBXFEA-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C13H5Cl2N3/c14-12-9(6-16)11(8-4-2-1-3-5-8)10(7-17)13(15)18-12/h1-5H | 
A data sheet from the Compendium of Pesticide Common Names