| Approval: |
China |
| IUPAC PIN: |
3-methyl-1-phenyl-1H-pyrazol-5-yl dimethylcarbamate |
| IUPAC name: |
3-methyl-1-phenyl-1H-pyrazol-5-yl dimethylcarbamate |
| CAS name: |
3-methyl-1-phenyl-1H-pyrazol-5-yl N,N-dimethylcarbamate |
| CAS Reg. No.: |
87-47-8 |
| Formula: |
C13H15N3O2 |
| Activity: |
insecticides (dimethylcarbamate) |
| Notes: |
There is no ISO common name for this substance; the name “pyrolan” (吡唑威) is approved in China, even though Pyrolan is (or was) a registered trade mark in many countries. |
| Structure: |
 |
| Pronunciation: |
pīr-ō-lǎn Guide to British pronunciation |
| InChIKey: |
GEDIWDLJKRKBFT-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C13H15N3O2/c1-10-9-12(18-13(17)15(2)3)16(14-10)11-7-5-4-6-8-11/h4-9H,1-3H3 |