| Approval: | ISO |
|---|---|
| IUPAC PIN: | 1-(8-hydroxyquinolin-5-yl)ethan-1-one |
| IUPAC name: | 5-acetylquinolin-8-ol |
| CAS name: | 1-(8-hydroxy-5-quinolinyl)ethanone |
| CAS Reg. No.: | 2598-31-4 |
| Formula: | C11H9NO2 |
| Activity: | fungicides (quinoline) |
| Notes: | Derivatives include quinacetol sulfate [57130-91-3] for the 2:1 sulfate salt. The name “quinacetol sulphate” was formerly approved for the 2:1 sulfate salt, but it was replaced by the name “quinacetol” for the base. |
| Structure: |  |
| Pronunciation: | kwǐn-ǎs-ǐ-tǒl Guide to British pronunciation |
| InChIKey: | HZTCLDNADGMACV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H9NO2/c1-7(13)8-4-5-10(14)11-9(8)3-2-6-12-11/h2-6,14H,1H3 |