Approval: | ISO |
---|---|
IUPAC PIN: | 3,7-dichloroquinoline-8-carboxylic acid |
IUPAC name: | 3,7-dichloroquinoline-8-carboxylic acid |
CAS name: | 3,7-dichloro-8-quinolinecarboxylic acid |
CAS Reg. No.: | 84087-01-4 |
Formula: | C10H5Cl2NO2 |
Activity: | herbicides (quinolinecarboxylic acid) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example quinclorac-dimethylammonium [84087-48-9], quinclorac-methyl [84087-33-2]. |
Structure: | |
Pronunciation: | kwǐn-klor-ǎk Guide to British pronunciation |
InChIKey: | FFSSWMQPCJRCRV-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H5Cl2NO2/c11-6-3-5-1-2-7(12)8(10(14)15)9(5)13-4-6/h1-4H,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names