| Approval: | USSR |
|---|---|
| IUPAC PIN: | N,N-diethylbenzamide |
| IUPAC name: | N,N-diethylbenzamide |
| CAS name: | N,N-diethylbenzamide |
| CAS Reg. No.: | 1696-17-9 |
| Formula: | C11H15NO |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “rebemide” (ребемид) was used in the former USSR. |
| Structure: | |
| Pronunciation: | rěb-ě-mīd Guide to British pronunciation |
| InChIKey: | JLNGEXDJAQASHD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names