Approval: | ISO |
---|---|
IUPAC PIN: | mixture of 55–45% (3S,6R)-3-methyl-6-(prop-1-en-2-yl)dec-9-en-1-yl acetate and 45–55% (3S,6S)-3-methyl-6-(prop-1-en-2-yl)dec-9-en-1-yl acetate |
IUPAC name: | mixture of 55–45% (3S,6R)-6-isopropenyl-3-methyldec-9-en-1-yl acetate and 45–55% (3S,6S)-6-isopropenyl-3-methyldec-9-en-1-yl acetate 1979 Rules: mixture of 55–45% (3S,6R)-6-isopropenyl-3-methyldec-9-enyl acetate and 45–55% (3S,6S)-6-isopropenyl-3-methyldec-9-enyl acetate |
CAS name: | (3S)-3-methyl-6-(1-methylethenyl)-9-decen-1-yl acetate |
CAS Reg. No.: | 64309-03-1 |
Formula: | C16H28O2 |
Activity: | insect attractants (Homopteran) |
Notes: | The name “rescalure” was originally wrongly applied to any mixture of the four possible diastereoisomers. |
Structure: | |
Pronunciation: | rěs-ka-lūr Guide to British pronunciation |
InChIKey: | UJJKWQRTTYLTQL-LBAUFKAWSA-N |
InChI: | InChI=1S/C16H28O2/c1-6-7-8-16(13(2)3)10-9-14(4)11-12-18-15(5)17/h6,14,16H,1-2,7-12H2,3-5H3/t14-,16?/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names