| Approval: | none |
|---|---|
| IUPAC PIN: | ethyl (2E,4E,7S)-3,7,11-trimethyldodeca-2,4-dienoate |
| IUPAC name: | ethyl (E,E),(S)-3,7,11-trimethyldodeca-2,4-dienoate |
| CAS name: | ethyl (2E,4E,7S)-3,7,11-trimethyl-2,4-dodecadienoate |
| CAS Reg. No.: | 65733-18-8 |
| Formula: | C17H30O2 |
| Activity: | insecticides (juvenile hormone mimic) |
| Notes: | The name “S-hydroprene” is used in the literature for this isomer, which has been used commercially, but it has no official approval. The racemic mixture [41096-46-2] has the ISO common name hydroprene. |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | FYQGBXGJFWXIPP-OJROSNHMSA-N |
| InChI: | InChI=1S/C17H30O2/c1-6-19-17(18)13-16(5)12-8-11-15(4)10-7-9-14(2)3/h8,12-15H,6-7,9-11H2,1-5H3/b12-8+,16-13+/t15-/m0/s1 |