| Approval: | China |
|---|---|
| IUPAC PIN: | N′-1,3-dithiolan-2-ylidenebenzohydrazide |
| IUPAC name: | N′-(1,3-dithiolan-2-ylidene)benzohydrazide or 2-benzoylhydrazono-1,3-dithiolane |
| CAS name: | benzoic acid 1,3-dithiolan-2-ylidenehydrazide |
| CAS Reg. No.: | 62303-19-9 |
| Formula: | C10H10N2OS2 |
| Activity: | bactericides fungicides (hydrazide) |
| Notes: | There is no ISO common name for this substance; the name “saijunmao” (噻菌茂) is approved in China. The name “qingkuling” has been used in the literature, but it has no official approval. The heterocyclic 5-membered 1,3-dithiolane ring is incorrectly shown as 3-membered dithiirane in GB 4839-2009 Chinese common names for pesticides. |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | SMPSKHUQMNCDEB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H10N2OS2/c13-9(8-4-2-1-3-5-8)11-12-10-14-6-7-15-10/h1-5H,6-7H2,(H,11,13) |