| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | 2-hydroxy-N-phenylbenzamide |
| IUPAC name: | 2-hydroxybenzanilide 1979 Rules: salicylanilide |
| CAS name: | 2-hydroxy-N-phenylbenzamide |
| CAS Reg. No.: | 87-17-2 |
| Formula: | C13H11NO2 |
| Activity: | fungicides (phenylbenzamide) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |  |
| Pronunciation: | sǎl-ǐ-sīl-ǎn-ǐ-līd Guide to British pronunciation |
| InChIKey: | WKEDVNSFRWHDNR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H11NO2/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10/h1-9,15H,(H,14,16) |