| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | (3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,5,5a,9b-tetrahydronaphtho[1,2-b]furan-2,8(3H,4H)-dione |
| IUPAC name: | (3S,3aS,5aS,9bS)-3a,5,5a,9b-tetrahydro-3,5a,9-trimethylnaphtho[1,2-b]furan-2,8(3H,4H)-dione |
| CAS name: | (3S,3aS,5aS,9bS)-3a,5,5a,9b-tetrahydro-3,5a,9-trimethylnaphtho[1,2-b]furan-2,8(3H,4H)-dione |
| CAS Reg. No.: | 481-06-1 |
| Formula: | C15H18O3 |
| Activity: | fungicides (botanical) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The structure is incorrectly shown and named with three 6-membered rings in GB 4839-2009 Chinese common names for pesticides. |
| Structure: |  |
| Pronunciation: | sǎnt-ō-nǐn Guide to British pronunciation |
| InChIKey: | XJHDMGJURBVLLE-BOCCBSBMSA-N |
| InChI: | InChI=1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3/t8-,10-,13-,15-/m0/s1 |