Approval: | ISO common name not required |
---|---|
IUPAC PIN: | rac-5-{(1R)-1-[2-(2-ethoxyethoxy)ethoxy]ethoxy}-2H-1,3-benzodioxole |
IUPAC name: | (RS)-5-{1-[2-(2-ethoxyethoxy)ethoxy]ethoxy}-1,3-benzodioxole |
CAS name: | 5-[1-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-1,3-benzodioxole |
CAS Reg. No.: | 51-14-9 |
Formula: | C15H22O6 |
Activity: | synergists |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | sě-sa-měks Guide to British pronunciation |
InChIKey: | WABPPBHOPMUJHV-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H22O6/c1-3-16-6-7-17-8-9-18-12(2)21-13-4-5-14-15(10-13)20-11-19-14/h4-5,10,12H,3,6-9,11H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names