Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 5-[(1S,3aR,4R,6aR)-4-(2H-1,3-benzodioxol-5-yloxy)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2H-1,3-benzodioxole |
IUPAC name: | 1,3-benzodioxol-5-yl (1R,3aR,4S,6aR)-4-(1,3-benzodioxol-5-yl)perhydrofuro[3,4-c]furan-1-yl ether |
CAS name: | (1S,3aR,4R,6aR)-5-[4-(1,3-benzodioxol-5-yloxy)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole |
CAS Reg. No.: | 526-07-8 |
Formula: | C20H18O7 |
Activity: | synergists |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | sě-sa-mō-lǐn Guide to British pronunciation |
InChIKey: | ZZMNWJVJUKMZJY-AFHBHXEDSA-N |
InChI: | InChI=1S/C20H18O7/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)27-12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19+,20+/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names