| Approval: | ESA |
|---|---|
| IUPAC PIN: | (2Ξ)-butan-2-yl (1Ξ,6Ξ)-6-methylcyclohex-3-ene-1-carboxylate |
| IUPAC name: | (RS)-sec-butyl (1RS,6RS;1RS,6SR)-6-methylcyclohex-3-ene-1-carboxylate |
| CAS name: | 1-methylpropyl 6-methyl-3-cyclohexene-1-carboxylate |
| CAS Reg. No.: | 2425-20-9 |
| Formula: | C12H20O2 |
| Activity: | insect attractants (Dipteran) |
| Notes: | There is no ISO common name for this substance; the name “siglure” is approved by the Entomological Society of America. |
| Structure: | |
| Pronunciation: | sǐg-lūr Guide to British pronunciation |
| InChIKey: | AJKDXAOKNSFWAA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H20O2/c1-4-10(3)14-12(13)11-8-6-5-7-9(11)2/h5-6,9-11H,4,7-8H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names