| Approval: | China |
|---|---|
| IUPAC PIN: | 1-(4-chlorophenyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| IUPAC name: | 1-(4-chlorophenyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| CAS name: | 1-(4-chlorophenyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| CAS Reg. No.: | 29025-67-0 |
| Formula: | C12H16ClNO3Si |
| Activity: | rodenticides (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “silatrane” (毒鼠硅) is approved in China. The name “silatrane” is normally used for 2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane [283-60-3]. |
| Structure: |  |
| Pronunciation: | sǐl-a-trān Guide to British pronunciation |
| InChIKey: | IKFVTMCLFHXPQF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H16ClNO3Si/c13-11-1-3-12(4-2-11)18-15-8-5-14(6-9-16-18)7-10-17-18/h1-4H,5-10H2 |