| Approval: | ISO | 
|---|---|
| IUPAC PIN: | 1-(4-chlorophenyl)-5-(2-methoxyethoxy)-4-oxo-1,4-dihydrocinnoline-3-carboxylic acid | 
| IUPAC name: | 1-(4-chlorophenyl)-1,4-dihydro-5-(2-methoxyethoxy)-4-oxocinnoline-3-carboxylic acid | 
| CAS name: | 1-(4-chlorophenyl)-1,4-dihydro-5-(2-methoxyethoxy)-4-oxo-3-cinnolinecarboxylic acid | 
| CAS Reg. No.: | 130561-48-7 | 
| Formula: | C18H15ClN2O5 | 
| Activity: | plant growth regulators (gametocide) | 
| Notes: | The name “cintofen” has been used in the literature, but it has no official approval. The Chinese name “津奥啉” has also been used in the literature. | 
| Structure: | |
| Pronunciation: | sǐn-tō-fěn Guide to British pronunciation | 
| InChIKey: | QLMNCUHSDAGQGT-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C18H15ClN2O5/c1-25-9-10-26-14-4-2-3-13-15(14)17(22)16(18(23)24)20-21(13)12-7-5-11(19)6-8-12/h2-8H,9-10H2,1H3,(H,23,24) | 
A data sheet from the Compendium of Pesticide Common Names