| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | sodium fluoroacetate |
| IUPAC name: | sodium fluoroacetate |
| CAS name: | sodium 2-fluoroacetate |
| CAS Reg. No.: | 62-74-8 |
| Formula: | C2H2FNaO2 |
| Activity: | rodenticides (halogenated alkanoic acid) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The parent acid, fluoroacetic acid [144-49-0], is also considered not to require a common name. |
| Structure: |  |
| Pronunciation: | sō-dē-am floo-a-rō-ǎs-ǐ-tāt Guide to British pronunciation |
| InChIKey: | JGFYQVQAXANWJU-UHFFFAOYSA-M |
| InChI: | InChI=1S/C2H3FO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |