Approval: | ISO common name not required |
---|---|
IUPAC PIN: | sodium pentachlorophenoxide |
IUPAC name: | sodium pentachlorophenolate or sodium pentachlorophenoxide |
CAS name: | 2,3,4,5,6-pentachlorophenol sodium salt |
CAS Reg. No.: | 131-52-2 |
Formula: | C6Cl5NaO |
Activity: | fungicides (phenol) molluscicides |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name with the name “sodium pentachlorophenoxide” as an alternative. The name “PCP-Na” (五氯酚钠) is approved in China. The parent alcohol is also considered not to require a common name, see pentachlorophenol [87-86-5]. |
Structure: | |
Pronunciation: | sō-dē-am pěn-ta-klor-ō-fěn-āt Guide to British pronunciation |
InChIKey: | HCJLVWUMMKIQIM-UHFFFAOYSA-M |
InChI: | InChI=1S/C6HCl5O.Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names