Approval: | ISO common name not required |
---|---|
IUPAC PIN: | disodium carbono(dithioperoxo)dithioate |
IUPAC name: | sodium tetrathio(peroxycarbonate) |
CAS name: | disodium carbono(dithioperoxo)dithioate or disodium tetrathioperoxycarbonate or sodium thioperoxycarbonate (Na2CS4) |
CAS Reg. No.: | 7345-69-9 |
Formula: | CNa2S4 |
Activity: | fungicides (thiocarbonate) insecticides (thiocarbonate) nematicides (thiocarbonate) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. This substance degrades to form carbon disulfide gas, the biologically active fumigant. |
Structure: | |
Pronunciation: | sō-dē-am tě-tra-thī-ō-kar-ba-nāt Guide to British pronunciation |
InChIKey: | HZBLLTXMVMMHRJ-UHFFFAOYSA-L |
InChI: | InChI=1S/CH2S4.2Na/c2-1(3)5-4;;/h4H,(H,2,3);;/q;2*+1/p-2 |
A data sheet from the Compendium of Pesticide Common Names