Approval: | none |
---|---|
IUPAC PIN: | rac-(2R)-6-methylhept-5-en-2-ol |
IUPAC name: | (RS)-6-methylhept-5-en-2-ol |
CAS name: | 6-methyl-5-hepten-2-ol |
CAS Reg. No.: | 4630-06-2 |
Formula: | C8H16O |
Activity: | insect attractants (Coleopteran) |
Notes: | There is no ISO common name for this substance; the name “sulcatol” has been used in the literature but it has no official approval. This substance is named after the insect from which it was isolated, Gnathotrichus sulcatus (LeConte) (Scolytidae, Coleoptera). |
Structure: | |
Pronunciation: | sǔl-ka-tǒl Guide to British pronunciation |
InChIKey: | OHEFFKYYKJVVOX-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H16O/c1-7(2)5-4-6-8(3)9/h5,8-9H,4,6H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names