| Approval: | ISO | 
|---|---|
| IUPAC PIN: | 2-chloroprop-2-en-1-yl diethylcarbamodithioate | 
| IUPAC name: | 2-chloroallyl diethylcarbamodithioate 1979 Rules: 2-chloroallyl diethyl(dithiocarbamate)  | 
| CAS name: | 2-chloro-2-propen-1-yl N,N-diethylcarbamodithioate | 
| CAS Reg. No.: | 95-06-7 | 
| Formula: | C8H14ClNS2 | 
| Activity: | herbicides (thiocarbamate) | 
| Notes: | The name “CDEC” is approved by the Weed Science Society of America. | 
| Structure: | |
| Pronunciation: | sǔlf-ǎl-āt Guide to British pronunciation | 
| InChIKey: | XJCLWVXTCRQIDI-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C8H14ClNS2/c1-4-10(5-2)8(11)12-6-7(3)9/h3-6H2,1-2H3 | 
A data sheet from the Compendium of Pesticide Common Names