Approval: | ISO |
---|---|
IUPAC PIN: | 2-chloroprop-2-en-1-yl diethylcarbamodithioate |
IUPAC name: | 2-chloroallyl diethylcarbamodithioate 1979 Rules: 2-chloroallyl diethyl(dithiocarbamate) |
CAS name: | 2-chloro-2-propen-1-yl N,N-diethylcarbamodithioate |
CAS Reg. No.: | 95-06-7 |
Formula: | C8H14ClNS2 |
Activity: | herbicides (thiocarbamate) |
Notes: | The name “CDEC” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | sǔlf-ǎl-āt Guide to British pronunciation |
InChIKey: | XJCLWVXTCRQIDI-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H14ClNS2/c1-4-10(5-2)8(11)12-6-7(3)9/h3-6H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names