| Approval: | ESA |
|---|---|
| IUPAC PIN: | rac-5-[(2R)-2-(octane-1-sulfinyl)propyl]-2H-1,3-benzodioxole |
| IUPAC name: | (1RS)-2-(1,3-benzodioxol-5-yl)-1-methylethyl octyl sulfoxide or (1RS)-1-methyl-2-(3,4-methylenedioxyphenyl)ethyl octyl sulfoxide |
| CAS name: | 5-[2-(octylsulfinyl)propyl]-1,3-benzodioxole |
| CAS Reg. No.: | 120-62-7 |
| Formula: | C18H28O3S |
| Activity: | synergists |
| Notes: | There is no ISO common name for this substance; the name “sulfoxide” is approved by the Entomological Society of America, and is also approved in China (增效砜). |
| Structure: |  |
| Pronunciation: | sǔl-fǒk-sīd Guide to British pronunciation |
| InChIKey: | ATTZFSUZZUNHBP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H28O3S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17/h9-10,13,15H,3-8,11-12,14H2,1-2H3 |