Status: | ISO 1750 (approved) |
---|---|
IUPAC PIN: | N1,N1,N12,N12-tetramethyl-4,9-disulfanylidene-2,3,10,11-tetrathia-5,8-diazadodecanedithioamide |
IUPAC name: | N′,N′,N‴,N‴-tetramethyl-N,N″-ethylenedi(thiuram disulfide) or N,N,N′,N′-tetramethyl-4,9-dithioxo-2,3,10,11-tetrathia-5,8-diazadodecanedithioamide |
CAS name: | N1,N1,N12,N12-tetramethyl-4,9-dithioxo-2,3,10,11-tetrathia-5,8-diazadodecanedithioamide |
CAS Reg. No.: | 5836-23-7 |
Formula: | C10H18N4S8 |
Activity: | fungicides (alkylenebis(dithiocarbamate)) |
Notes: | The name “tecoram” was formerly approved by the British Standards Institution and was adopted by ISO in 2020. |
Structure: | |
Pronunciation: | těk-or-ǎm Guide to British pronunciation |
InChIKey: | OTWBGXPTCSGQEJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H18N4S8/c1-13(2)9(17)21-19-7(15)11-5-6-12-8(16)20-22-10(18)14(3)4/h5-6H2,1-4H3,(H,11,15)(H,12,16) |
A data sheet from the Compendium of Pesticide Common Names