Approval: | ISO |
---|---|
IUPAC PIN: | N-[(3,5-dichloro-2,4-difluorophenyl)carbamoyl]-2,6-difluorobenzamide |
IUPAC name: | N-[(3,5-dichloro-2,4-difluorophenyl)carbamoyl]-2,6-difluorobenzamide 1979 Rules: 1-(3,5-dichloro-2,4-difluorophenyl)-3-(2,6-difluorobenzoyl)urea |
CAS name: | N-[[(3,5-dichloro-2,4-difluorophenyl)amino]carbonyl]-2,6-difluorobenzamide |
CAS Reg. No.: | 83121-18-0 |
Formula: | C14H6Cl2F4N2O2 |
Activity: | insecticides (benzoylurea) |
Notes: | The Chinese name “伏虫隆” has also been used in the literature, but it has no official approval. |
Structure: | |
Pronunciation: | tě-floo-běnz-ūr-ǒn Guide to British pronunciation |
InChIKey: | CJDWRQLODFKPEL-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H6Cl2F4N2O2/c15-5-4-8(12(20)10(16)11(5)19)21-14(24)22-13(23)9-6(17)2-1-3-7(9)18/h1-4H,(H2,21,22,23,24) |
A data sheet from the Compendium of Pesticide Common Names