Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 1,1,2,2-tetrachloroethane |
IUPAC name: | 1,1,2,2-tetrachloroethane |
CAS name: | 1,1,2,2-tetrachloroethane |
CAS Reg. No.: | 79-34-5 |
Formula: | C2H2Cl4 |
Activity: | insecticides (alkyl halide; fumigant) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | tě-tra-klor-ō-ē-thān Guide to British pronunciation |
InChIKey: | QPFMBZIOSGYJDE-UHFFFAOYSA-N |
InChI: | InChI=1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H |
A data sheet from the Compendium of Pesticide Common Names