| Approval: | ISO | 
|---|---|
| IUPAC PIN: | 1,2,4-trichloro-5-[(4-chlorophenyl)sulfanyl]benzene | 
| IUPAC name: | 4-chlorophenyl 2,4,5-trichlorophenyl sulfide | 
| CAS name: | 1,2,4-trichloro-5-[(4-chlorophenyl)thio]benzene | 
| CAS Reg. No.: | 2227-13-6 | 
| Formula: | C12H6Cl4S | 
| Activity: | acaricides (diphenylsulfide) | 
| Notes: | The name “tetradisul” is used in Canada, and the name “diphenyl sulphide” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. | 
| Structure: | |
| Pronunciation: | tě-tra-sǔl Guide to British pronunciation | 
| InChIKey: | QUWSDLYBOVGOCW-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C12H6Cl4S/c13-7-1-3-8(4-2-7)17-12-6-10(15)9(14)5-11(12)16/h1-6H | 
A data sheet from the Compendium of Pesticide Common Names