Approval: | China |
---|---|
IUPAC PIN: | (2E)-3-(2-chlorophenyl)-3-oxo-2-(4-phenyl-1,3-thiazol-2(3H)-ylidene)propanenitrile |
IUPAC name: | (2E)-3-(2-chlorophenyl)-3-oxo-2-(4-phenylthiazol-2(3H)-ylidene)propanenitrile 1979 Rules: (2E)-3-(2-chlorophenyl)-3-oxo-2-(4-phenylthiazol-2(3H)-ylidene)propiononitrile |
CAS name: | (αE)-2-chloro-β-oxo-α-(4-phenyl-2(3H)-thiazolylidene)benzenepropanenitrile |
CAS Reg. No.: | 77768-58-2 |
Formula: | C18H11ClN2OS |
Activity: | insecticides (beta-ketonitrile) |
Notes: | There is no ISO common name for this substance; the name “thiapronil” (噻丙腈) is approved in China. |
Structure: | |
Pronunciation: | thī-a-prō-nǐl Guide to British pronunciation |
InChIKey: | VBXLZVRONLPCMO-NBVRZTHBSA-N |
InChI: | InChI=1S/C18H11ClN2OS/c19-15-9-5-4-8-13(15)17(22)14(10-20)18-21-16(11-23-18)12-6-2-1-3-7-12/h1-9,11,21H/b18-14+ |
A data sheet from the Compendium of Pesticide Common Names