| Approval: | ISO | 
|---|---|
| IUPAC PIN: | S-[(4-chlorophenyl)methyl] diethylcarbamothioate | 
| IUPAC name: | S-(4-chlorobenzyl) diethylcarbamothioate 1979 Rules: S-(4-chlorobenzyl) diethyl(thiocarbamate)  | 
| CAS name: | S-[(4-chlorophenyl)methyl] N,N-diethylcarbamothioate | 
| CAS Reg. No.: | 28249-77-6 | 
| Formula: | C12H16ClNOS | 
| Activity: | herbicides (thiocarbamate) | 
| Notes: | The name “benthiocarb” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. | 
| Structure: | |
| Pronunciation: | thī-ō-běn-karb Guide to British pronunciation | 
| InChIKey: | QHTQREMOGMZHJV-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C12H16ClNOS/c1-3-14(4-2)12(15)16-9-10-5-7-11(13)8-6-10/h5-8H,3-4,9H2,1-2H3 | 
A data sheet from the Compendium of Pesticide Common Names