Approval: | ISO |
---|---|
IUPAC PIN: | S-[(4-chlorophenyl)methyl] diethylcarbamothioate |
IUPAC name: | S-(4-chlorobenzyl) diethylcarbamothioate 1979 Rules: S-(4-chlorobenzyl) diethyl(thiocarbamate) |
CAS name: | S-[(4-chlorophenyl)methyl] N,N-diethylcarbamothioate |
CAS Reg. No.: | 28249-77-6 |
Formula: | C12H16ClNOS |
Activity: | herbicides (thiocarbamate) |
Notes: | The name “benthiocarb” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | thī-ō-běn-karb Guide to British pronunciation |
InChIKey: | QHTQREMOGMZHJV-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H16ClNOS/c1-3-14(4-2)12(15)16-9-10-5-7-11(13)8-6-10/h5-8H,3-4,9H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names