| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | hydrazinecarbothioamide |
| IUPAC name: | hydrazinecarbothioamide |
| CAS name: | hydrazinecarbothioamide |
| CAS Reg. No.: | 79-19-6 |
| Formula: | CH5N3S |
| Activity: | rodenticides (thiourea) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | thī-ō-sěm-ē-karb-a-zīd Guide to British pronunciation |
| InChIKey: | BRWIZMBXBAOCCF-UHFFFAOYSA-N |
| InChI: | InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) |
A data sheet from the Compendium of Pesticide Common Names