Approval: | ISO |
---|---|
IUPAC PIN: | (5Ξ)-2-[(1Ξ)-N-ethoxypropanimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one |
IUPAC name: | (RS)-2-[(EZ)-1-(ethoxyimino)propyl]-3-hydroxy-5-mesitylcyclohex-2-en-1-one |
CAS name: | 2-[1-(ethoxyimino)propyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)-2-cyclohexen-1-one |
CAS Reg. No.: | 87820-88-0 |
Formula: | C20H27NO3 |
Activity: | herbicides (cyclohexanedione oxime) |
Notes: | The Chinese name “肟草酮” has also been used in the literature, but it has no official approval. |
Structure: | |
Pronunciation: | trǎlk-ǒk-sē-dǐm Guide to British pronunciation |
InChIKey: | DQFPEYARZIQXRM-UHFFFAOYSA-N |
InChI: | InChI=1S/C20H27NO3/c1-6-16(21-24-7-2)20-17(22)10-15(11-18(20)23)19-13(4)8-12(3)9-14(19)5/h8-9,15,22H,6-7,10-11H2,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names