| Approval: |
ISO common name not required |
| IUPAC PIN: |
1,3,5-trichloro-2,4,6-trinitrobenzene |
| IUPAC name: |
1,3,5-trichloro-2,4,6-trinitrobenzene |
| CAS name: |
1,3,5-trichloro-2,4,6-trinitrobenzene |
| CAS Reg. No.: |
2631-68-7 (28260-63-1 for unspecified isomer) |
| Formula: |
C6Cl3N3O6 |
| Activity: |
fungicides (nitrobenzene) |
| Notes: |
This substance is considered by the International Organization for Standardization not to require a common name, though there seems to be only one active isomer. |
| Structure: |
 |
| Pronunciation: |
trī-klor-ō-trī-nī-trō-běn-zēnz Guide to British pronunciation |
| InChIKey: |
LZMONXBJUOXABQ-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C6Cl3N3O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16 |