| Approval: | ISO |
|---|---|
| IUPAC PIN: | the PIN of the major component is (2Ξ,6Ξ)-2,6-dimethyl-4-tridecylmorpholine |
| IUPAC name: | reaction mixture of 4-alkyl-2,6-dimethylmorpholines, where “alkyl” is mixture of C11–C14 homologues of which 60–70% is tridecyl |
| CAS name: | tridemorph |
| CAS Reg. No.: | 81412-43-3 |
| Formula: | C19H39NO (major component) |
| Activity: | fungicides (morpholine) |
| Notes: | The name “tridemorph” was originally approved for the single isomer 2,6-dimethyl-4-tridecylmorpholine [24602-86-6] but it is actually a reaction mixture and the definition was changed. |
| Structure: |  |
| Pronunciation: | trī-dē-morf Guide to British pronunciation |
| InChIKey: | major component: YTOPFCCWCSOHFV-UHFFFAOYSA-N |
| InChI: | major component: InChI=1S/C19H39NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-20-16-18(2)21-19(3)17-20/h18-19H,4-17H2,1-3H3 |