tridemorph

Chinese: 十三吗啉French: tridémorphe (n.m.)Russian: тридеморф


Approval: ISO
IUPAC PIN: the PIN of the major component is (2Ξ,6Ξ)-2,6-dimethyl-4-tridecylmorpholine
IUPAC name: reaction mixture of 4-alkyl-2,6-dimethylmorpholines, where “alkyl” is mixture of C11–C14 homologues of which 60–70% is tridecyl
CAS name: tridemorph
CAS Reg. No.: 81412-43-3
Formula: C19H39NO (major component)
Activity: fungicides (morpholine)
Notes: The name “tridemorph” was originally approved for the single isomer 2,6-dimethyl-4-tridecylmorpholine [24602-86-6] but it is actually a reaction mixture and the definition was changed.
Structure: Structural formula of tridemorph
Pronunciation: trī-dē-morf  Guide to British pronunciation
InChIKey: major component:
YTOPFCCWCSOHFV-UHFFFAOYSA-N
InChI: major component:
InChI=1S/C19H39NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-20-16-18(2)21-19(3)17-20/h18-19H,4-17H2,1-3H3

A data sheet from the Compendium of Pesticide Common Names