| Approval: | ISO | 
|---|---|
| IUPAC PIN: | mixture of 60–80% rac-3,4,4-trifluorobut-3-en-1-yl (2R,3R)-2-(2-methoxyphenyl)-5-oxooxolane-3-carboxylate and 40–20% of the rac-(2R,3S)-isomers | 
| IUPAC name: | mixture of 60–80% trans-isomers 3,4,4-trifluorobut-3-enyl (2RS,3RS)-2-(2-methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylate and 40–20% of the cis-isomers 3,4,4-trifluorobut-3-enyl (2RS,3SR)-2-(2-methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylate 1979 Rules: mixture of 60–80% trans-isomers 3,4,4-trifluorobut-3-enyl (2RS,3RS)-tetrahydro-2-(2-methoxyphenyl)-5-oxofuran-3-carboxylate and 40–20% of the cis-isomers 3,4,4-trifluorobut-3-enyl (2RS,3SR)-tetrahydro-2-(2-methoxyphenyl)-5-oxofuran-3-carboxylate | 
| CAS name: | 3,4,4-trifluoro-3-buten-1-yl tetrahydro-2-(2-methoxyphenyl)-5-oxo-3-furancarboxylate | 
| CAS Reg. No.: | 2074661-82-6 | 
| Formula: | C16H15F3O5 | 
| Activity: | acaricides (fluoroalkene) nematicides (fluoroalkene) | 
| Notes: | The names sanfoshaxianzhi and Trifluorocide have been used in the literature. The mixture of 2 trans-isomers has the CAS Registry Number 2094595-23-8. | 
| Structure: | |
| Pronunciation: | trī-floo-ěn-fūr-ǒn-āt Guide to British pronunciation | 
| InChIKey: | VDQRIZJOECVEPJ-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C16H15F3O5/c1-22-12-5-3-2-4-9(12)14-10(8-13(20)24-14)16(21)23-7-6-11(17)15(18)19/h2-5,10,14H,6-8H2,1H3 | 
A data sheet from the Compendium of Pesticide Common Names