| Approval: | ISO |
|---|---|
| IUPAC PIN: | reaction product comprising from 3.5 to 5 parts by mass of 3,4,5-trimethylphenyl methylcarbamate to 1 part by mass of 2,3,5-trimethylphenyl methylcarbamate |
| IUPAC name: | reaction product comprising from 3.5 to 5 parts by mass of 3,4,5-trimethylphenyl methylcarbamate to 1 part by mass of 2,3,5-trimethylphenyl methylcarbamate |
| CAS name: | 2,3,5(or 3,4,5)-trimethylphenyl N-methylcarbamate |
| CAS Reg. No.: | 12407-86-2 |
| Formula: | C11H15NO2 |
| Activity: | bird repellents insecticides (phenyl carbamate) mammal repellents molluscicides |
| Notes: | The CAS Registry Numbers of the components are 2655-15-4 (2,3,5-isomer) and 2686-99-9 (3,4,5-isomer). |
| Structure: |  |
| Pronunciation: | trī-měth-a-karb Guide to British pronunciation |
| InChIKey: | 2,3,5-trimethylphenyl methylcarbamate: NYOKZHDTNBDPOB-UHFFFAOYSA-N 3,4,5-trimethylphenyl methylcarbamate: AUQAUAIUNJIIEP-UHFFFAOYSA-N identifier for mixture (not valid): CNBWXTCSMFEZDM-UHFFFAOYSA-N |
| InChI: | 2,3,5-trimethylphenyl methylcarbamate: InChI=1S/C11H15NO2/c1-7-5-8(2)9(3)10(6-7)14-11(13)12-4/h5-6H,1-4H3,(H,12,13) 3,4,5-trimethylphenyl methylcarbamate: InChI=1S/C11H15NO2/c1-7-5-10(14-11(13)12-4)6-8(2)9(7)3/h5-6H,1-4H3,(H,12,13) |