| Approval: | WSSA |
|---|---|
| IUPAC PIN: | rac-(2R)-1-[(2,3,6-trichlorophenyl)methoxy]propan-2-ol |
| IUPAC name: | (RS)-1-[(2,3,6-trichlorobenzyl)oxy]propan-2-ol |
| CAS name: | 1-[(2,3,6-trichlorophenyl)methoxy]-2-propanol |
| CAS Reg. No.: | 1861-44-5 |
| Formula: | C10H11Cl3O2 |
| Activity: | herbicides (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “tritac” is approved by the Weed Science Society of America. |
| Structure: | |
| Pronunciation: | trī-tǎk Guide to British pronunciation |
| InChIKey: | LJWIIRATRWPHBA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H11Cl3O2/c1-6(14)4-15-5-7-8(11)2-3-9(12)10(7)13/h2-3,6,14H,4-5H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names