| Approval: | WSSA | 
|---|---|
| IUPAC PIN: | rac-(2R)-1-[(2,3,6-trichlorophenyl)methoxy]propan-2-ol | 
| IUPAC name: | (RS)-1-[(2,3,6-trichlorobenzyl)oxy]propan-2-ol | 
| CAS name: | 1-[(2,3,6-trichlorophenyl)methoxy]-2-propanol | 
| CAS Reg. No.: | 1861-44-5 | 
| Formula: | C10H11Cl3O2 | 
| Activity: | herbicides (unclassified) | 
| Notes: | There is no ISO common name for this substance; the name “tritac” is approved by the Weed Science Society of America. | 
| Structure: | |
| Pronunciation: | trī-tǎk Guide to British pronunciation | 
| InChIKey: | LJWIIRATRWPHBA-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C10H11Cl3O2/c1-6(14)4-15-5-7-8(11)2-3-9(12)10(7)13/h2-3,6,14H,4-5H2,1H3 | 
A data sheet from the Compendium of Pesticide Common Names