| Approval: | JMAFF |
|---|---|
| IUPAC PIN: | bis(dimethylcarbamodithioic) methylarsonodithious bis(thioanhydride) |
| IUPAC name: | bis(dimethylcarbamodithioic) methylarsonodithious bis(thioanhydride) 1979 Rules: bis(dimethyldithiocarbamic) methyldithioarsonous bis(thioanhydride) |
| CAS name: | N,N-dimethylcarbamodithioic acid C,C′-bis(anhydrosulfide) with As-methylarsonodithious acid |
| CAS Reg. No.: | 2445-07-0 |
| Formula: | C7H15AsN2S4 |
| Activity: | fungicides (arsenical; dimethyldithiocarbamate) |
| Notes: | There is no ISO common name for this substance; the name “urbacide” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (福美甲胂), even though Urbacid is (or was) a registered trade mark in many countries. |
| Structure: | |
| Pronunciation: | erb-a-sīd Guide to British pronunciation |
| InChIKey: | FRDDEJAABOMVCH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H15AsN2S4/c1-8(13-6(11)9(2)3)14-7(12)10(4)5/h1-5H3 |
A data sheet from the Compendium of Pesticide Common Names