Approval: | China |
---|---|
IUPAC PIN: | rac-(3-phenoxyphenyl)methyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
IUPAC name: | 3-phenoxybenzyl (2RS)-2-(4-chlorophenyl)-3-methylbutanoate 1979 Rules: 3-phenoxybenzyl (2RS)-2-(4-chlorophenyl)-3-methylbutyrate |
CAS name: | (3-phenoxyphenyl)methyl 4-chloro-α-(1-methylethyl)benzeneacetate |
CAS Reg. No.: | 51630-33-2 |
Formula: | C24H23ClO3 |
Activity: | insecticides (pyrethroid isovalerate ester) |
Notes: | There is no ISO common name for this substance; the name “valerate” (戊菊酯) is approved in China. |
Structure: | |
Pronunciation: | vǎl-er-āt Guide to British pronunciation |
InChIKey: | ZVBYGQHSOONVCF-UHFFFAOYSA-N |
InChI: | InChI=1S/C24H23ClO3/c1-17(2)23(19-11-13-20(25)14-12-19)24(26)27-16-18-7-6-10-22(15-18)28-21-8-4-3-5-9-21/h3-15,17,23H,16H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names