| Approval: | JMAFF |
|---|---|
| IUPAC name: | (1R,2R,3S,4S,6R)-2,3-dihydroxy-6-(hydroxymethyl)-4-{[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl β-D-glucopyranoside |
| CAS name: | 1,5,6-trideoxy-4-O-β-D-glucopyranosyl-5-(hydroxymethyl)-1-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-D-chiro-inositol |
| CAS Reg. No.: | 37248-47-8 |
| Formula: | C20H35NO13 |
| Activity: | fungicides (glucopyranoside) |
| Notes: | There is no ISO common name for this substance; the name “validamycin” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. The name “Jinganmycin A” (井冈霉素) is approved in China. There are several validamycins; this one is also known as “validamycin A”. |
| Structure: | |
| Pronunciation: | vǎl-īd-a-mī-sǐn Guide to British pronunciation |
| InChIKey: | JARYYMUOCXVXNK-CSLFJTBJSA-N |
| InChI: | InChI=1S/C20H35NO13/c22-3-6-1-8(12(26)15(29)11(6)25)21-9-2-7(4-23)19(17(31)13(9)27)34-20-18(32)16(30)14(28)10(5-24)33-20/h1,7-32H,2-5H2/t7-,8+,9+,10-,11-,12+,13+,14-,15+,16+,17-,18-,19-,20+/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names