| Approval: | none |
|---|---|
| IUPAC PIN: | rac-4-[(1R)-1-(but-2-yn-1-yloxy)ethyl]-1,2-dimethoxybenzene |
| IUPAC name: | 4-[(1RS)-1-(but-2-ynyloxy)ethyl]-1,2-dimethoxybenzene 1979 Rules: 4-[(RS)-1-(but-2-ynyloxy)ethyl]veratrole |
| CAS name: | 4-[1-(2-butyn-1-yloxy)ethyl]-1,2-dimethoxybenzene |
| CAS Reg. No.: | 185676-84-0 |
| Formula: | C14H18O3 |
| Activity: | synergists |
| Notes: | There is no ISO common name for this substance; the name “verbutin” has been used in the literature but it has no official approval. Verbutin® is a registered trademark for products containing the antimycobacterial agent rifabutin. |
| Structure: |  |
| Pronunciation: | ver-bū-tǐn Guide to British pronunciation |
| InChIKey: | LABQLTFAPITERI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H18O3/c1-5-6-9-17-11(2)12-7-8-13(15-3)14(10-12)16-4/h7-8,10-11H,9H2,1-4H3 |