| Approval: | ISO |
|---|---|
| IUPAC PIN: | 3,4-dimethylphenyl methylcarbamate |
| IUPAC name: | 3,4-dimethylphenyl methylcarbamate 1979 Rules: 3,4-xylyl methylcarbamate |
| CAS name: | 3,4-dimethylphenyl N-methylcarbamate |
| CAS Reg. No.: | 2425-10-7 |
| Formula: | C10H13NO2 |
| Activity: | insecticides (phenyl carbamate) |
| Notes: | The name “MPMC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | zī-līl-karb Guide to British pronunciation |
| InChIKey: | WCJYTPVNMWIZCG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H13NO2/c1-7-4-5-9(6-8(7)2)13-10(12)11-3/h4-6H,1-3H3,(H,11,12) |