| Approval: | China |
|---|---|
| IUPAC PIN: | (3aΞ,4Ξ,7Ξ,7aΞ)-2-[(2Ξ)-2-ethylhexyl]-3a,4,7,7a-tetrahydro-4,7-methano-1H-isoindole-1,3(2H)-dione |
| IUPAC name: | N-(2-ethylhexyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboximide 1979 Rules: N-(2-ethylhexyl)-8,9,10-trinorborn-5-ene-2,3-dicarboximide |
| CAS name: | 2-(2-ethylhexyl)-3a,4,7,7a-tetrahydro-4,7-methano-1H-isoindole-1,3(2H)-dione |
| CAS Reg. No.: | 113-48-4 |
| Formula: | C17H25NO2 |
| Activity: | synergists |
| Notes: | There is no ISO common name for this substance; the name “zengxiaoan” (增效胺) is approved in China. The substance is commonly known as MGK-264, a manufactures code number. |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | WLLGXSLBOPFWQV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C17H25NO2/c1-3-5-6-11(4-2)10-18-16(19)14-12-7-8-13(9-12)15(14)17(18)20/h7-8,11-15H,3-6,9-10H2,1-2H3 |