Approval: | ISO |
---|---|
IUPAC PIN: | 2,3,6-trichlorobenzoic acid |
IUPAC name: | 2,3,6-trichlorobenzoic acid |
CAS name: | 2,3,6-trichlorobenzoic acid |
CAS Reg. No.: | 50-31-7 |
Formula: | C7H3Cl3O2 |
Activity: | herbicides (benzoic acid) |
Notes: | Derivatives include 2,3,6-TBA-dimethylammonium [3426-62-8], 2,3,6-TBA-lithium [71750-37-3], 2,3,6-TBA-potassium [4559-30-2], 2,3,6-TBA-sodium [2078-42-4]. The name “TCBA” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | too thrē sǐks tē bē ā Guide to British pronunciation |
InChIKey: | XZIDTOHMJBOSOX-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H3Cl3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names