| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | lithium 2,3,6-trichlorobenzoate |
| IUPAC name: | lithium 2,3,6-trichlorobenzoate |
| CAS name: | lithium 2,3,6-trichlorobenzoate |
| CAS Reg. No.: | 71750-37-3 |
| Formula: | C7H2Cl3LiO2 |
| Activity: | herbicides (benzoic acid) |
| Notes: | This substance is a derivative of 2,3,6-TBA [50-31-7]. |
| Structure: | |
| Pronunciation: | too thrē sǐks tē bē ā lǐth-ē-am Guide to British pronunciation |
| InChIKey: | JLUHDLXQXJRHKA-UHFFFAOYSA-M |
| InChI: | InChI=1S/C7H3Cl3O2.Li/c8-3-1-2-4(9)6(10)5(3)7(11)12;/h1-2H,(H,11,12);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names