Approval: | ISO |
---|---|
IUPAC PIN: | 1,2,3-benzothiadiazole-7-carbothioic S-acid |
IUPAC name: | 1,2,3-benzothiadiazole-7-carbothioic S-acid 1979 Rules: benzo[1,2,3]thiadiazole-7-carbothioic S-acid |
CAS name: | 1,2,3-benzothiadiazole-7-carbothioic acid |
CAS Reg. No.: | 126448-41-7 |
Formula: | C7H4N2OS2 |
Activity: | fungicides (benzothiadiazole) plant activators |
Notes: | Derivatives include acibenzolar-S-methyl [135158-54-2]. |
Structure: | |
Pronunciation: | ǎ-sǐ-běn-zō-lar Guide to British pronunciation |
InChIKey: | CGIHPACLZJDCBQ-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H4N2OS2/c10-7(11)4-2-1-3-5-6(4)12-9-8-5/h1-3H,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names