| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | S-methyl 1,2,3-benzothiadiazole-7-carbothioate |
| IUPAC name: | S-methyl benzo[1,2,3]thiadiazole-7-carbothioate |
| CAS name: | S-methyl 1,2,3-benzothiadiazole-7-carbothioate |
| CAS Reg. No.: | 135158-54-2 |
| Formula: | C8H6N2OS2 |
| Activity: | fungicides (benzothiadiazole) plant activators |
| Notes: | This substance is a derivative of acibenzolar [126448-41-7]. The names “benzothiadiazole” and “BTH” have been used in the literature, but they have no official approval. |
| Structure: |  |
| Pronunciation: | ǎ-sǐ-běn-zō-lar ěs mē-thīl Guide to British pronunciation |
| InChIKey: | UELITFHSCLAHKR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H6N2OS2/c1-12-8(11)5-3-2-4-6-7(5)13-10-9-6/h2-4H,1H3 |