Approval: | ISO |
---|---|
IUPAC PIN: | (phenylazanediyl)diethane-2,1-diyl bis(3,6-dichloro-2-methoxybenzoate) |
IUPAC name: | 2,2′-(phenylimino)diethylene bis(3,6-dichloro-o-anisate) or 2,2′-(phenylimino)diethylene bis(3,6-dichloro-2-methoxybenzoate) |
CAS name: | (phenylimino)di-2,1-ethanediyl bis(3,6-dichloro-2-methoxybenzoate) |
CAS Reg. No.: | 56141-00-5 |
Formula: | C26H23Cl4NO6 |
Activity: | herbicides (benzoic acid) |
Notes: | This substance is a complex ester of dicamba [1918-00-9]. |
Structure: | |
Pronunciation: | kǎm-běn-dǐ-klor Guide to British pronunciation |
InChIKey: | ILXXYQLPPNVJDP-UHFFFAOYSA-N |
InChI: | InChI=1S/C26H23Cl4NO6/c1-34-23-19(29)10-8-17(27)21(23)25(32)36-14-12-31(16-6-4-3-5-7-16)13-15-37-26(33)22-18(28)9-11-20(30)24(22)35-2/h3-11H,12-15H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names