| Approval: | ISO |
|---|---|
| IUPAC PIN: | 3,6-dichloro-2-methoxybenzoic acid |
| IUPAC name: | 3,6-dichloro-2-methoxybenzoic acid 1979 Rules: 3,6-dichloro-o-anisic acid |
| CAS name: | 3,6-dichloro-2-methoxybenzoic acid |
| CAS Reg. No.: | 1918-00-9 |
| Formula: | C8H6Cl2O3 |
| Activity: | herbicides (benzoic acid) |
| Notes: | Derivatives include dicamba-biproamine [1286239-22-2], dicamba-diglycolamine [104040-79-1], dicamba-dimethylammonium [2300-66-5], dicamba-diolamine [25059-78-3], dicamba-isopropylammonium [55871-02-8], dicamba-methyl [6597-78-0], dicamba-olamine [53404-28-7], dicamba-potassium [10007-85-9], dicamba-sodium [1982-69-0], dicamba-trolamine [53404-29-8]. The name “dianat” (дианат) was used in the former USSR. The name “disugran” was formerly used in the USA for dicamba-methyl. The names “dicamba” and “dicamba-methyl” were both formerly approved by ISO, but “dicamba-methyl” was deleted. One complex ester has its own ISO common name, cambendichlor [56141-00-5]. |
| Structure: |  |
| Pronunciation: | dī-kǎm-ba Guide to British pronunciation |
| InChIKey: | IWEDIXLBFLAXBO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H6Cl2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-3H,1H3,(H,11,12) |